C23H23N3O5 — CID 108534205
2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 108534205) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108534205 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)CCN3C(=O)c4ccccc4C3=O)CC2)c1 |
| InChI | InChI=1S/C23H23N3O5/c1-31-17-6-4-5-16(15-17)21(28)25-13-11-24(12-14-25)20(27)9-10-26-22(29)18-7-2-3-8-19(18)23(26)30/h2-8,15H,9-14H2,1H3 |
| InChIKey | HPZSKUAYUZJVGY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|