C17H23N3O4S — CID 38047605
2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]sulfanylacetamide (PubChem CID 38047605) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]sulfanylacetamide.
| Compound Name | 2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]sulfanylacetamide |
|---|---|
| PubChem CID | 38047605 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[3-[4-(3-methoxybenzoyl)piperazin-1-yl]-3-oxopropyl]sulfanylacetamide |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)CCSCC(N)=O)CC2)c1 |
| InChI | InChI=1S/C17H23N3O4S/c1-24-14-4-2-3-13(11-14)17(23)20-8-6-19(7-9-20)16(22)5-10-25-12-15(18)21/h2-4,11H,5-10,12H2,1H3,(H2,18,21) |
| InChIKey | QHRAVIVFUZYQHI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|