C15H14N2O5S — CID 95989117
methyl (4R)-3-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 95989117) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is methyl (4R)-3-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (4R)-3-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 95989117 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | methyl (4R)-3-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CSCN1C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14N2O5S/c1-22-15(21)11-7-23-8-17(11)12(18)6-16-13(19)9-4-2-3-5-10(9)14(16)20/h2-5,11H,6-8H2,1H3/t11-/m0/s1 |
| InChIKey | HSPKVTFUKZTAME-NSHDSACASA-N |
| XLogP | 0.36 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|