C15H14N2O3S — CID 122272798
2-[2-oxo-2-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)ethyl]isoindole-1,3-dione (PubChem CID 122272798) has the molecular formula C15H14N2O3S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[2-oxo-2-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-2-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122272798 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[2-oxo-2-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N1CC2CC1CS2 |
| InChI | InChI=1S/C15H14N2O3S/c18-13(16-6-10-5-9(16)8-21-10)7-17-14(19)11-3-1-2-4-12(11)15(17)20/h1-4,9-10H,5-8H2 |
| InChIKey | UQAHTUAPGKRZOZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|