C24H18N2O3 — CID 101049937
2-[2-[(2S,3S)-2,3-diphenylaziridin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 101049937) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[2-[(2S,3S)-2,3-diphenylaziridin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S,3S)-2,3-diphenylaziridin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101049937 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[2-[(2S,3S)-2,3-diphenylaziridin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N1[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H18N2O3/c27-20(15-25-23(28)18-13-7-8-14-19(18)24(25)29)26-21(16-9-3-1-4-10-16)22(26)17-11-5-2-6-12-17/h1-14,21-22H,15H2/t21-,22-/m0/s1 |
| InChIKey | IJEHAZWOYFPPHS-VXKWHMMOSA-N |
| XLogP | 3.61 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|