C32H25N3O4 — CID 18940622
2-[2-(1-benzyl-2-oxo-4-phenyl-3,4-dihydro-1,5-benzodiazepin-5-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 18940622) has the molecular formula C32H25N3O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-[2-(1-benzyl-2-oxo-4-phenyl-3,4-dihydro-1,5-benzodiazepin-5-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(1-benzyl-2-oxo-4-phenyl-3,4-dihydro-1,5-benzodiazepin-5-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18940622 |
| Molecular Formula | C32H25N3O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 2-[2-(1-benzyl-2-oxo-4-phenyl-3,4-dihydro-1,5-benzodiazepin-5-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N1c2ccccc2N(Cc2ccccc2)C(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C32H25N3O4/c36-29-19-28(23-13-5-2-6-14-23)35(30(37)21-34-31(38)24-15-7-8-16-25(24)32(34)39)27-18-10-9-17-26(27)33(29)20-22-11-3-1-4-12-22/h1-18,28H,19-21H2 |
| InChIKey | ZHIXOESNXYDFRI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|