C33H27N3O4 — CID 67779890
2-[2-[5-(naphthalen-1-ylmethyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 67779890) has the molecular formula C33H27N3O4 and a molecular weight of 529.60 g/mol. Its IUPAC name is 2-[2-[5-(naphthalen-1-ylmethyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5-(naphthalen-1-ylmethyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67779890 |
| Molecular Formula | C33H27N3O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 2-[2-[5-(naphthalen-1-ylmethyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N1c2ccccc2N(Cc2cccc3ccccc23)C(=O)C2CCCC21 |
| InChI | InChI=1S/C33H27N3O4/c37-30(20-35-31(38)24-13-3-4-14-25(24)32(35)39)36-27-18-8-15-26(27)33(40)34(28-16-5-6-17-29(28)36)19-22-11-7-10-21-9-1-2-12-23(21)22/h1-7,9-14,16-17,26-27H,8,15,18-20H2 |
| InChIKey | XAORHXOEEAODLH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|