C28H25ClN4O4 — CID 139697517
2-[2-[(3aS,10aR)-4-oxo-5-(pyridin-4-ylmethyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 139697517) has the molecular formula C28H25ClN4O4 and a molecular weight of 516.99 g/mol. Its IUPAC name is 2-[2-[(3aS,10aR)-4-oxo-5-(pyridin-4-ylmethyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-[(3aS,10aR)-4-oxo-5-(pyridin-4-ylmethyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 139697517 |
| Molecular Formula | C28H25ClN4O4 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-[2-[(3aS,10aR)-4-oxo-5-(pyridin-4-ylmethyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1CC(=O)N1c2ccccc2N(Cc2ccncc2)C(=O)[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C28H24N4O4.ClH/c33-25(17-31-26(34)19-6-1-2-7-20(19)27(31)35)32-22-11-5-8-21(22)28(36)30(16-18-12-14-29-15-13-18)23-9-3-4-10-24(23)32;/h1-4,6-7,9-10,12-15,21-22H,5,8,11,16-17H2;1H/t21-,22+;/m0./s1 |
| InChIKey | IEKAFHZTKMGPLH-UMIAIAFLSA-N |
| XLogP | 3.85 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|