C29H24FN3O4 — CID 70111456
2-[2-[(3aS,10aR)-5-benzyl-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]-5-fluoroisoindole-1,3-dione (PubChem CID 70111456) has the molecular formula C29H24FN3O4 and a molecular weight of 497.53 g/mol. Its IUPAC name is 2-[2-[(3aS,10aR)-5-benzyl-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]-5-fluoroisoindole-1,3-dione.
| Compound Name | 2-[2-[(3aS,10aR)-5-benzyl-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]-5-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 70111456 |
| Molecular Formula | C29H24FN3O4 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-[2-[(3aS,10aR)-5-benzyl-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-10-yl]-2-oxoethyl]-5-fluoroisoindole-1,3-dione |
| SMILES | O=C1c2ccc(F)cc2C(=O)N1CC(=O)N1c2ccccc2N(Cc2ccccc2)C(=O)[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C29H24FN3O4/c30-19-13-14-20-22(15-19)29(37)32(27(20)35)17-26(34)33-23-12-6-9-21(23)28(36)31(16-18-7-2-1-3-8-18)24-10-4-5-11-25(24)33/h1-5,7-8,10-11,13-15,21,23H,6,9,12,16-17H2/t21-,23+/m0/s1 |
| InChIKey | LRASVFDESUZLAX-JTHBVZDNSA-N |
| XLogP | 4.17 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|