C31H34N4O2 — CID 70133756
(3aS,10aR)-5-benzyl-10-[2-(4-phenylpiperazin-1-yl)acetyl]-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-4-one (PubChem CID 70133756) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (3aS,10aR)-5-benzyl-10-[2-(4-phenylpiperazin-1-yl)acetyl]-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-4-one.
| Compound Name | (3aS,10aR)-5-benzyl-10-[2-(4-phenylpiperazin-1-yl)acetyl]-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-4-one |
|---|---|
| PubChem CID | 70133756 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (3aS,10aR)-5-benzyl-10-[2-(4-phenylpiperazin-1-yl)acetyl]-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-4-one |
| SMILES | O=C1[C@H]2CCC[C@H]2N(C(=O)CN2CCN(c3ccccc3)CC2)c2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C31H34N4O2/c36-30(23-32-18-20-33(21-19-32)25-12-5-2-6-13-25)35-27-17-9-14-26(27)31(37)34(22-24-10-3-1-4-11-24)28-15-7-8-16-29(28)35/h1-8,10-13,15-16,26-27H,9,14,17-23H2/t26-,27+/m0/s1 |
| InChIKey | QZVIWTWAFVUFKX-RRPNLBNLSA-N |
| XLogP | 4.56 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |