C26H28N4O4 — CID 51620013
(3S)-1-benzyl-3-[4-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 51620013) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is (3S)-1-benzyl-3-[4-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-benzyl-3-[4-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51620013 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (3S)-1-benzyl-3-[4-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN([C@H]3CC(=O)N(Cc4ccccc4)C3=O)CC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H28N4O4/c31-23-15-21(25(33)29(23)17-19-7-3-1-4-8-19)27-11-13-28(14-12-27)22-16-24(32)30(26(22)34)18-20-9-5-2-6-10-20/h1-10,21-22H,11-18H2/t21-,22-/m0/s1 |
| InChIKey | PBYFCNZSOJYRQZ-VXKWHMMOSA-N |
| XLogP | 1.26 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|