C19H27N3O2 — CID 30635283
(3R)-3-(4-benzylpiperazin-1-yl)-1-butylpyrrolidine-2,5-dione (PubChem CID 30635283) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (3R)-3-(4-benzylpiperazin-1-yl)-1-butylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzylpiperazin-1-yl)-1-butylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 30635283 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (3R)-3-(4-benzylpiperazin-1-yl)-1-butylpyrrolidine-2,5-dione |
| SMILES | CCCCN1C(=O)C[C@@H](N2CCN(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C19H27N3O2/c1-2-3-9-22-18(23)14-17(19(22)24)21-12-10-20(11-13-21)15-16-7-5-4-6-8-16/h4-8,17H,2-3,9-15H2,1H3/t17-/m1/s1 |
| InChIKey | DVRPOFDOWMVYGL-QGZVFWFLSA-N |
| XLogP | 1.73 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|