C30H31ClN4O4 — CID 18940625
2-[2-[1-benzyl-2-oxo-4-(propylaminomethyl)-3,4-dihydro-1,5-benzodiazepin-5-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 18940625) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 2-[2-[1-benzyl-2-oxo-4-(propylaminomethyl)-3,4-dihydro-1,5-benzodiazepin-5-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-[1-benzyl-2-oxo-4-(propylaminomethyl)-3,4-dihydro-1,5-benzodiazepin-5-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 18940625 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 2-[2-[1-benzyl-2-oxo-4-(propylaminomethyl)-3,4-dihydro-1,5-benzodiazepin-5-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | CCCNCC1CC(=O)N(Cc2ccccc2)c2ccccc2N1C(=O)CN1C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C30H30N4O4.ClH/c1-2-16-31-18-22-17-27(35)32(19-21-10-4-3-5-11-21)25-14-8-9-15-26(25)34(22)28(36)20-33-29(37)23-12-6-7-13-24(23)30(33)38;/h3-15,22,31H,2,16-20H2,1H3;1H |
| InChIKey | GKMUGIVJYAOJFY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|