C26H26N4O6 — CID 11191037
N,N'-bis[(1-benzyl-2,5-dioxopyrrolidin-3-yl)methyl]oxamide (PubChem CID 11191037) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is N,N'-bis[(1-benzyl-2,5-dioxopyrrolidin-3-yl)methyl]oxamide.
| Compound Name | N,N'-bis[(1-benzyl-2,5-dioxopyrrolidin-3-yl)methyl]oxamide |
|---|---|
| PubChem CID | 11191037 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N,N'-bis[(1-benzyl-2,5-dioxopyrrolidin-3-yl)methyl]oxamide |
| SMILES | O=C(NCC1CC(=O)N(Cc2ccccc2)C1=O)C(=O)NCC1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H26N4O6/c31-21-11-19(25(35)29(21)15-17-7-3-1-4-8-17)13-27-23(33)24(34)28-14-20-12-22(32)30(26(20)36)16-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2,(H,27,33)(H,28,34) |
| InChIKey | HNZQUHXEOLBTHK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|