C22H22N3O4+ — CID 7456285
[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7456285) has the molecular formula C22H22N3O4+ and a molecular weight of 392.44 g/mol. Its IUPAC name is [(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | [(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7456285 |
| Molecular Formula | C22H22N3O4+ |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | O=C1C[C@H]([NH2+][C@@H]2CC(=O)N(Cc3ccccc3)C2=O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H21N3O4/c26-19-11-17(21(28)24(19)13-15-7-3-1-4-8-15)23-18-12-20(27)25(22(18)29)14-16-9-5-2-6-10-16/h1-10,17-18,23H,11-14H2/p+1/t17-,18+ |
| InChIKey | IJXICEILORLYEJ-HDICACEKSA-O |
| XLogP | 0.21 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|