C13H15NO2S — CID 132966694
1-benzyl-3-ethylsulfanylpyrrolidine-2,5-dione (PubChem CID 132966694) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-benzyl-3-ethylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-benzyl-3-ethylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 132966694 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-benzyl-3-ethylsulfanylpyrrolidine-2,5-dione |
| SMILES | CCSC1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C13H15NO2S/c1-2-17-11-8-12(15)14(13(11)16)9-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3 |
| InChIKey | XKHAUHKKJAVICB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|