C18H14NO4S- — CID 6923602
2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate (PubChem CID 6923602) has the molecular formula C18H14NO4S- and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate.
| Compound Name | 2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 6923602 |
| Molecular Formula | C18H14NO4S- |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
| SMILES | O=C([O-])c1ccccc1S[C@H]1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H15NO4S/c20-16-10-15(24-14-9-5-4-8-13(14)18(22)23)17(21)19(16)11-12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,22,23)/p-1/t15-/m0/s1 |
| InChIKey | FPQBGNKSJQDCDX-HNNXBMFYSA-M |
| XLogP | 1.47 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|