C17H10Cl2NO4S- — CID 2234321
2-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate (PubChem CID 2234321) has the molecular formula C17H10Cl2NO4S- and a molecular weight of 395.24 g/mol. Its IUPAC name is 2-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate.
| Compound Name | 2-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 2234321 |
| Molecular Formula | C17H10Cl2NO4S- |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 2-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
| SMILES | O=C([O-])c1ccccc1S[C@@H]1CC(=O)N(c2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C17H11Cl2NO4S/c18-10-5-3-6-11(15(10)19)20-14(21)8-13(16(20)22)25-12-7-2-1-4-9(12)17(23)24/h1-7,13H,8H2,(H,23,24)/p-1/t13-/m1/s1 |
| InChIKey | OKDMQTXQFOWUAU-CYBMUJFWSA-M |
| XLogP | 2.78 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|