C17H11INO4S- — CID 4653975
2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate (PubChem CID 4653975) has the molecular formula C17H11INO4S- and a molecular weight of 452.25 g/mol. Its IUPAC name is 2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate.
| Compound Name | 2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 4653975 |
| Molecular Formula | C17H11INO4S- |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | 2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
| SMILES | O=C([O-])c1ccccc1SC1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C17H12INO4S/c18-10-5-7-11(8-6-10)19-15(20)9-14(16(19)21)24-13-4-2-1-3-12(13)17(22)23/h1-8,14H,9H2,(H,22,23)/p-1 |
| InChIKey | AXCSSGFAMMVEMR-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|