C12H9INO4S- — CID 7377865
2-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate (PubChem CID 7377865) has the molecular formula C12H9INO4S- and a molecular weight of 390.18 g/mol. Its IUPAC name is 2-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate.
| Compound Name | 2-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 7377865 |
| Molecular Formula | C12H9INO4S- |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | 2-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate |
| SMILES | O=C([O-])CS[C@H]1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C12H10INO4S/c13-7-1-3-8(4-2-7)14-10(15)5-9(12(14)18)19-6-11(16)17/h1-4,9H,5-6H2,(H,16,17)/p-1/t9-/m0/s1 |
| InChIKey | AFYVLXCMQVUVPG-VIFPVBQESA-M |
| XLogP | 0.41 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|