C12H12FNO2S — CID 92639985
(3R)-3-ethylsulfanyl-1-(4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 92639985) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is (3R)-3-ethylsulfanyl-1-(4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-ethylsulfanyl-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 92639985 |
| Molecular Formula | C12H12FNO2S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (3R)-3-ethylsulfanyl-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | CCS[C@@H]1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C12H12FNO2S/c1-2-17-10-7-11(15)14(12(10)16)9-5-3-8(13)4-6-9/h3-6,10H,2,7H2,1H3/t10-/m1/s1 |
| InChIKey | QBSADOPKTIYYKE-SNVBAGLBSA-N |
| XLogP | 2.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|