C23H22N2O4S2 — CID 132966697
3-[3-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylpropylsulfanyl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 132966697) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-[3-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylpropylsulfanyl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-[3-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylpropylsulfanyl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 132966697 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 3-[3-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylpropylsulfanyl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(SCCCSC2CC(=O)N(c3ccccc3)C2=O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H22N2O4S2/c26-20-14-18(22(28)24(20)16-8-3-1-4-9-16)30-12-7-13-31-19-15-21(27)25(23(19)29)17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2 |
| InChIKey | WPJOOISLHBRZIK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|