C14H16BrNO2S — CID 51389715
(3R)-1-(4-bromophenyl)-3-butylsulfanylpyrrolidine-2,5-dione (PubChem CID 51389715) has the molecular formula C14H16BrNO2S and a molecular weight of 342.26 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-3-butylsulfanylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-bromophenyl)-3-butylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51389715 |
| Molecular Formula | C14H16BrNO2S |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-3-butylsulfanylpyrrolidine-2,5-dione |
| SMILES | CCCCS[C@@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C14H16BrNO2S/c1-2-3-8-19-12-9-13(17)16(14(12)18)11-6-4-10(15)5-7-11/h4-7,12H,2-3,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | RYPYLRDDRPAUDX-GFCCVEGCSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|