C19H17FN2O3S — CID 7372003
3-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-fluorophenyl)propanamide (PubChem CID 7372003) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-fluorophenyl)propanamide.
| Compound Name | 3-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 7372003 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-fluorophenyl)propanamide |
| SMILES | O=C(CCS[C@@H]1CC(=O)N(c2ccccc2)C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O3S/c20-13-6-8-14(9-7-13)21-17(23)10-11-26-16-12-18(24)22(19(16)25)15-4-2-1-3-5-15/h1-9,16H,10-12H2,(H,21,23)/t16-/m1/s1 |
| InChIKey | KFLPVCMFSAVEJH-MRXNPFEDSA-N |
| XLogP | 3.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|