C20H20N2O4S — CID 1243819
2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide (PubChem CID 1243819) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1243819 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CS[C@@H]2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-2-26-16-10-8-14(9-11-16)21-18(23)13-27-17-12-19(24)22(20(17)25)15-6-4-3-5-7-15/h3-11,17H,2,12-13H2,1H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | SYTCNVYISJBDNA-QGZVFWFLSA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|