C20H19ClN2O4S — CID 1109118
N-(4-chlorophenyl)-2-[(3S)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide (PubChem CID 1109118) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(3S)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(3S)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1109118 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(3S)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
| SMILES | CCOc1cccc(N2C(=O)C[C@H](SCC(=O)Nc3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C20H19ClN2O4S/c1-2-27-16-5-3-4-15(10-16)23-19(25)11-17(20(23)26)28-12-18(24)22-14-8-6-13(21)7-9-14/h3-10,17H,2,11-12H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | ZIXQVWPVRUZRKC-KRWDZBQOSA-N |
| XLogP | 3.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|