C22H17ClN2O3S — CID 1300027
2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide (PubChem CID 1300027) has the molecular formula C22H17ClN2O3S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 1300027 |
| Molecular Formula | C22H17ClN2O3S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide |
| SMILES | O=C(CS[C@H]1CC(=O)N(c2ccc(Cl)cc2)C1=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H17ClN2O3S/c23-16-6-9-18(10-7-16)25-21(27)12-19(22(25)28)29-13-20(26)24-17-8-5-14-3-1-2-4-15(14)11-17/h1-11,19H,12-13H2,(H,24,26)/t19-/m0/s1 |
| InChIKey | SYNUXSQZVNGBTA-IBGZPJMESA-N |
| XLogP | 4.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|