C22H16Cl2N2O3S — CID 1118615
2-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide (PubChem CID 1118615) has the molecular formula C22H16Cl2N2O3S and a molecular weight of 459.35 g/mol. Its IUPAC name is 2-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 1118615 |
| Molecular Formula | C22H16Cl2N2O3S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 2-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-naphthalen-2-ylacetamide |
| SMILES | O=C(CS[C@H]1CC(=O)N(c2ccc(Cl)c(Cl)c2)C1=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H16Cl2N2O3S/c23-17-8-7-16(10-18(17)24)26-21(28)11-19(22(26)29)30-12-20(27)25-15-6-5-13-3-1-2-4-14(13)9-15/h1-10,19H,11-12H2,(H,25,27)/t19-/m0/s1 |
| InChIKey | JFAFHJAYRIRFAW-IBGZPJMESA-N |
| XLogP | 5.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|