C12H8Cl2NO4S- — CID 6956893
2-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate (PubChem CID 6956893) has the molecular formula C12H8Cl2NO4S- and a molecular weight of 333.17 g/mol. Its IUPAC name is 2-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate.
| Compound Name | 2-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 6956893 |
| Molecular Formula | C12H8Cl2NO4S- |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 2-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate |
| SMILES | O=C([O-])CS[C@@H]1CC(=O)N(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C12H9Cl2NO4S/c13-7-2-1-6(3-8(7)14)15-10(16)4-9(12(15)19)20-5-11(17)18/h1-3,9H,4-5H2,(H,17,18)/p-1/t9-/m1/s1 |
| InChIKey | JVBPWORHZOGJBF-SECBINFHSA-M |
| XLogP | 1.11 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|