C17H18Cl2N2O3S2 — CID 99934805
[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6S)-2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 99934805) has the molecular formula C17H18Cl2N2O3S2 and a molecular weight of 433.38 g/mol. Its IUPAC name is [(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6S)-2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | [(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6S)-2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 99934805 |
| Molecular Formula | C17H18Cl2N2O3S2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | [(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6S)-2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | C[C@@H]1CN(C(=S)S[C@@H]2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C17H18Cl2N2O3S2/c1-9-7-20(8-10(2)24-9)17(25)26-14-6-15(22)21(16(14)23)11-3-4-12(18)13(19)5-11/h3-5,9-10,14H,6-8H2,1-2H3/t9-,10+,14-/m1/s1 |
| InChIKey | ODOLBJNOHBQOGW-ISTVAULSSA-N |
| XLogP | 3.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|