C19H15Cl2FN4O2S — CID 132772870
[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate (PubChem CID 132772870) has the molecular formula C19H15Cl2FN4O2S and a molecular weight of 453.33 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate.
| Compound Name | [1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 132772870 |
| Molecular Formula | C19H15Cl2FN4O2S |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate |
| SMILES | C/C(=N\N=C(N)SC1CC(=O)N(c2ccc(Cl)c(Cl)c2)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15Cl2FN4O2S/c1-10(11-2-4-12(22)5-3-11)24-25-19(23)29-16-9-17(27)26(18(16)28)13-6-7-14(20)15(21)8-13/h2-8,16H,9H2,1H3,(H2,23,25)/b24-10+ |
| InChIKey | NCPNPQGRSGNQMX-YSURURNPSA-N |
| XLogP | 4.24 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|