C17H19N3O5S2 — CID 100823443
[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 100823443) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is [(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | [(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 100823443 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | C[C@@H]1CN(C(=S)S[C@H]2CC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C17H19N3O5S2/c1-10-8-18(9-11(2)25-10)17(26)27-14-7-15(21)19(16(14)22)12-3-5-13(6-4-12)20(23)24/h3-6,10-11,14H,7-9H2,1-2H3/t10-,11+,14-/m0/s1 |
| InChIKey | PAXVYQBQXSRDCW-WDMOLILDSA-N |
| XLogP | 2.35 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|