C17H21N3O5S3 — CID 87047584
[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl] 2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 87047584) has the molecular formula C17H21N3O5S3 and a molecular weight of 443.57 g/mol. Its IUPAC name is [2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl] 2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | [2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl] 2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 87047584 |
| Molecular Formula | C17H21N3O5S3 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | [2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl] 2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | CC1CN(C(=S)SC2CC(=O)N(c3ccc(S(N)(=O)=O)cc3)C2=O)CC(C)O1 |
| InChI | InChI=1S/C17H21N3O5S3/c1-10-8-19(9-11(2)25-10)17(26)27-14-7-15(21)20(16(14)22)12-3-5-13(6-4-12)28(18,23)24/h3-6,10-11,14H,7-9H2,1-2H3,(H2,18,23,24) |
| InChIKey | HARZAVKWKDZNJH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|