C24H25N3O4S2 — CID 87048553
[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] 4-(4-acetylphenyl)piperazine-1-carbodithioate (PubChem CID 87048553) has the molecular formula C24H25N3O4S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] 4-(4-acetylphenyl)piperazine-1-carbodithioate.
| Compound Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] 4-(4-acetylphenyl)piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 87048553 |
| Molecular Formula | C24H25N3O4S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] 4-(4-acetylphenyl)piperazine-1-carbodithioate |
| SMILES | COc1ccc(N2C(=O)CC(SC(=S)N3CCN(c4ccc(C(C)=O)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H25N3O4S2/c1-16(28)17-3-5-18(6-4-17)25-11-13-26(14-12-25)24(32)33-21-15-22(29)27(23(21)30)19-7-9-20(31-2)10-8-19/h3-10,21H,11-15H2,1-2H3 |
| InChIKey | FVIRNAZDCCUBMD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|