C33H33N3O5S2 — CID 99129544
[(3R)-1-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate (PubChem CID 99129544) has the molecular formula C33H33N3O5S2 and a molecular weight of 615.78 g/mol. Its IUPAC name is [(3R)-1-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate.
| Compound Name | [(3R)-1-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 99129544 |
| Molecular Formula | C33H33N3O5S2 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | [(3R)-1-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(N3C(=O)C[C@@H](SC(=S)N4CCN(Cc5ccccc5)CC4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C33H33N3O5S2/c1-40-28-15-9-23(20-29(28)41-2)8-14-27(37)25-10-12-26(13-11-25)36-31(38)21-30(32(36)39)43-33(42)35-18-16-34(17-19-35)22-24-6-4-3-5-7-24/h3-15,20,30H,16-19,21-22H2,1-2H3/b14-8+/t30-/m1/s1 |
| InChIKey | MZLAQAVOLWHNOM-OOAGYTMSSA-N |
| XLogP | 5.07 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|