C30H33NO3 — CID 46871936
(E)-1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 46871936) has the molecular formula C30H33NO3 and a molecular weight of 455.60 g/mol. Its IUPAC name is (E)-1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46871936 |
| Molecular Formula | C30H33NO3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | (E)-1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(CN3CCC(Cc4ccccc4)CC3)c2)cc1OC |
| InChI | InChI=1S/C30H33NO3/c1-33-29-14-12-24(21-30(29)34-2)11-13-28(32)27-10-6-9-26(20-27)22-31-17-15-25(16-18-31)19-23-7-4-3-5-8-23/h3-14,20-21,25H,15-19,22H2,1-2H3/b13-11+ |
| InChIKey | MVNYJPNYPRDYAR-ACCUITESSA-N |
| XLogP | 6.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|