C25H32N2O3S — CID 71961591
3-(3,4-dimethoxyphenyl)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]prop-2-enamide (PubChem CID 71961591) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71961591 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCC2CCN(Cc3ccccc3SC)CC2)cc1OC |
| InChI | InChI=1S/C25H32N2O3S/c1-29-22-10-8-19(16-23(22)30-2)9-11-25(28)26-17-20-12-14-27(15-13-20)18-21-6-4-5-7-24(21)31-3/h4-11,16,20H,12-15,17-18H2,1-3H3,(H,26,28) |
| InChIKey | ZGQGCGVBBVAPAY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|