C21H26N4O3 — CID 121109116
(E)-3-(3,4-dimethoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]prop-2-enamide (PubChem CID 121109116) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 121109116 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCC2CCN(c3cnccn3)CC2)cc1OC |
| InChI | InChI=1S/C21H26N4O3/c1-27-18-5-3-16(13-19(18)28-2)4-6-21(26)24-14-17-7-11-25(12-8-17)20-15-22-9-10-23-20/h3-6,9-10,13,15,17H,7-8,11-12,14H2,1-2H3,(H,24,26)/b6-4+ |
| InChIKey | OOHJXPJHDJGIOK-GQCTYLIASA-N |
| XLogP | 2.54 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|