C25H30N2O4 — CID 108935511
(E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 108935511) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is (E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108935511 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(C(=O)N2CCC(CNC(=O)/C=C/c3ccc(C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C25H30N2O4/c1-18-4-6-19(7-5-18)8-11-24(28)26-17-20-12-14-27(15-13-20)25(29)21-9-10-22(30-2)23(16-21)31-3/h4-11,16,20H,12-15,17H2,1-3H3,(H,26,28)/b11-8+ |
| InChIKey | OEONSIYCUCEADL-DHZHZOJOSA-N |
| XLogP | 3.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|