C22H25ClN2O4 — CID 108935229
2-chloro-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]benzamide (PubChem CID 108935229) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-chloro-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 108935229 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-chloro-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)N2CCC(CNC(=O)c3ccccc3Cl)CC2)cc1OC |
| InChI | InChI=1S/C22H25ClN2O4/c1-28-19-8-7-16(13-20(19)29-2)22(27)25-11-9-15(10-12-25)14-24-21(26)17-5-3-4-6-18(17)23/h3-8,13,15H,9-12,14H2,1-2H3,(H,24,26) |
| InChIKey | TUILVDCDFUWEPJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |