C22H23F3N2O4 — CID 108935387
N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-2,3,4-trifluorobenzamide (PubChem CID 108935387) has the molecular formula C22H23F3N2O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108935387 |
| Molecular Formula | C22H23F3N2O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-2,3,4-trifluorobenzamide |
| SMILES | COc1ccc(C(=O)N2CCC(CNC(=O)c3ccc(F)c(F)c3F)CC2)cc1OC |
| InChI | InChI=1S/C22H23F3N2O4/c1-30-17-6-3-14(11-18(17)31-2)22(29)27-9-7-13(8-10-27)12-26-21(28)15-4-5-16(23)20(25)19(15)24/h3-6,11,13H,7-10,12H2,1-2H3,(H,26,28) |
| InChIKey | VUIBAQXPEYHVHV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|