C22H32N2O4 — CID 108935551
(E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3,4-dimethylpent-2-enamide (PubChem CID 108935551) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is (E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3,4-dimethylpent-2-enamide.
| Compound Name | (E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 108935551 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (E)-N-[[1-(3,4-dimethoxybenzoyl)piperidin-4-yl]methyl]-3,4-dimethylpent-2-enamide |
| SMILES | COc1ccc(C(=O)N2CCC(CNC(=O)/C=C(\C)C(C)C)CC2)cc1OC |
| InChI | InChI=1S/C22H32N2O4/c1-15(2)16(3)12-21(25)23-14-17-8-10-24(11-9-17)22(26)18-6-7-19(27-4)20(13-18)28-5/h6-7,12-13,15,17H,8-11,14H2,1-5H3,(H,23,25)/b16-12+ |
| InChIKey | VZFSTOBEHUCBPK-FOWTUZBSSA-N |
| XLogP | 3.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|