C15H14F6N2O2 — CID 108932810
2,3,4-trifluoro-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]benzamide (PubChem CID 108932810) has the molecular formula C15H14F6N2O2 and a molecular weight of 368.28 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 108932810 |
| Molecular Formula | C15H14F6N2O2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCN(C(=O)C(F)(F)F)CC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H14F6N2O2/c16-10-2-1-9(11(17)12(10)18)13(24)22-7-8-3-5-23(6-4-8)14(25)15(19,20)21/h1-2,8H,3-7H2,(H,22,24) |
| InChIKey | XBEBNICKLOSXBG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|