C14H15BrF3NO — CID 114317137
N-[[2-(bromomethyl)cyclopentyl]methyl]-2,3,4-trifluorobenzamide (PubChem CID 114317137) has the molecular formula C14H15BrF3NO and a molecular weight of 350.18 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclopentyl]methyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[[2-(bromomethyl)cyclopentyl]methyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 114317137 |
| Molecular Formula | C14H15BrF3NO |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[[2-(bromomethyl)cyclopentyl]methyl]-2,3,4-trifluorobenzamide |
| SMILES | O=C(NCC1CCCC1CBr)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H15BrF3NO/c15-6-8-2-1-3-9(8)7-19-14(20)10-4-5-11(16)13(18)12(10)17/h4-5,8-9H,1-3,6-7H2,(H,19,20) |
| InChIKey | LRKGRMXXCJXPEZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|