C25H30F2N2O4 — CID 55979215
3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]prop-2-enamide (PubChem CID 55979215) has the molecular formula C25H30F2N2O4 and a molecular weight of 460.52 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55979215 |
| Molecular Formula | C25H30F2N2O4 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]prop-2-enamide |
| SMILES | CCOc1cc(C=CC(=O)NC2CCN(Cc3ccccc3OC)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C25H30F2N2O4/c1-3-32-23-16-18(8-10-22(23)33-25(26)27)9-11-24(30)28-20-12-14-29(15-13-20)17-19-6-4-5-7-21(19)31-2/h4-11,16,20,25H,3,12-15,17H2,1-2H3,(H,28,30) |
| InChIKey | MKFBKLQAZIPLGX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|