C27H34N2O4 — CID 55553424
(E)-N-(1-cyclopropylpiperidin-4-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide (PubChem CID 55553424) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is (E)-N-(1-cyclopropylpiperidin-4-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1-cyclopropylpiperidin-4-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55553424 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (E)-N-(1-cyclopropylpiperidin-4-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NC2CCN(C3CC3)CC2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C27H34N2O4/c1-2-31-26-20-21(8-12-25(26)33-19-18-32-24-6-4-3-5-7-24)9-13-27(30)28-22-14-16-29(17-15-22)23-10-11-23/h3-9,12-13,20,22-23H,2,10-11,14-19H2,1H3,(H,28,30)/b13-9+ |
| InChIKey | QIVPYECDKYSRHF-UKTHLTGXSA-N |
| XLogP | 4.30 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|