C27H26N2O5 — CID 30873472
(E)-N-[4-(cyanomethoxy)phenyl]-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide (PubChem CID 30873472) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is (E)-N-[4-(cyanomethoxy)phenyl]-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(cyanomethoxy)phenyl]-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 30873472 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (E)-N-[4-(cyanomethoxy)phenyl]-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc(OCC#N)cc2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C27H26N2O5/c1-2-31-26-20-21(8-14-25(26)34-19-18-33-23-6-4-3-5-7-23)9-15-27(30)29-22-10-12-24(13-11-22)32-17-16-28/h3-15,20H,2,17-19H2,1H3,(H,29,30)/b15-9+ |
| InChIKey | ROXPOJLYYPQQRH-OQLLNIDSSA-N |
| XLogP | 5.10 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|