C29H32N2O5 — CID 46541731
4-[[[(E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enoyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 46541731) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is 4-[[[(E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enoyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[(E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enoyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 46541731 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 4-[[[(E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enoyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2ccc(C(=O)N(C)C)cc2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C29H32N2O5/c1-4-34-27-20-22(12-16-26(27)36-19-18-35-25-8-6-5-7-9-25)13-17-28(32)30-21-23-10-14-24(15-11-23)29(33)31(2)3/h5-17,20H,4,18-19,21H2,1-3H3,(H,30,32)/b17-13+ |
| InChIKey | ZMZSRXVGURZGNC-GHRIWEEISA-N |
| XLogP | 4.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|