C30H31N3O4 — CID 16625934
(E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 16625934) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 16625934 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2ccccc2Cn2cccn2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C30H31N3O4/c1-2-35-29-21-24(13-15-28(29)37-20-19-36-27-11-4-3-5-12-27)14-16-30(34)31-22-25-9-6-7-10-26(25)23-33-18-8-17-32-33/h3-18,21H,2,19-20,22-23H2,1H3,(H,31,34)/b16-14+ |
| InChIKey | FEQKXKYUJUWLMS-JQIJEIRASA-N |
| XLogP | 5.12 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|