C28H28N4O4 — CID 55619607
(E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]prop-2-enamide (PubChem CID 55619607) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55619607 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2ccnc(-n3cccn3)c2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C28H28N4O4/c1-2-34-26-19-22(9-11-25(26)36-18-17-35-24-7-4-3-5-8-24)10-12-28(33)30-21-23-13-15-29-27(20-23)32-16-6-14-31-32/h3-16,19-20H,2,17-18,21H2,1H3,(H,30,33)/b12-10+ |
| InChIKey | RFFGLWIGWSLFRI-ZRDIBKRKSA-N |
| XLogP | 4.45 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|